C13H15N5S — CID 135965124
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-1,3-thiazolidin-2-imine (PubChem CID 135965124) has the molecular formula C13H15N5S and a molecular weight of 273.37 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-1,3-thiazolidin-2-imine.
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135965124 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-1,3-thiazolidin-2-imine |
| SMILES | Cn1cnnc1C/N=C1/NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C13H15N5S/c1-18-9-15-17-12(18)7-14-13-16-11(8-19-13)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3,(H,14,16) |
| InChIKey | ZGBQQVZXWFEUES-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|