C14H19N3OS — CID 135965211
2-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]-N-propylacetamide (PubChem CID 135965211) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]-N-propylacetamide.
| Compound Name | 2-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 135965211 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[(4-phenyl-1,3-thiazolidin-2-ylidene)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C1/NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C14H19N3OS/c1-2-8-15-13(18)9-16-14-17-12(10-19-14)11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | NDGIKKLWNYQHCU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|