C15H21N3OS — CID 136713434
3-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide (PubChem CID 136713434) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide.
| Compound Name | 3-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 136713434 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CC/N=C1/NC(Cc2ccccc2)CS1 |
| InChI | InChI=1S/C15H21N3OS/c1-2-16-14(19)8-9-17-15-18-13(11-20-15)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | OSOPSOUWJVPUCA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|