C17H25N3S — CID 136666955
N-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethyl]-N-ethylcyclopropanamine (PubChem CID 136666955) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethyl]-N-ethylcyclopropanamine.
| Compound Name | N-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethyl]-N-ethylcyclopropanamine |
|---|---|
| PubChem CID | 136666955 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethyl]-N-ethylcyclopropanamine |
| SMILES | CCN(CC/N=C1/NC(Cc2ccccc2)CS1)C1CC1 |
| InChI | InChI=1S/C17H25N3S/c1-2-20(16-8-9-16)11-10-18-17-19-15(13-21-17)12-14-6-4-3-5-7-14/h3-7,15-16H,2,8-13H2,1H3,(H,18,19) |
| InChIKey | DUCLNHYLTJRNIP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|