C16H20N4S — CID 136908710
4-benzyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 136908710) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-benzyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-benzyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136908710 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-benzyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | Cc1c(C/N=C2/NC(Cc3ccccc3)CS2)cnn1C |
| InChI | InChI=1S/C16H20N4S/c1-12-14(10-18-20(12)2)9-17-16-19-15(11-21-16)8-13-6-4-3-5-7-13/h3-7,10,15H,8-9,11H2,1-2H3,(H,17,19) |
| InChIKey | YCAHAJIZGBTOQE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|