C11H15N3S — CID 135934660
4-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine (PubChem CID 135934660) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934660 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N/Cc2cccnc2)N1 |
| InChI | InChI=1S/C11H15N3S/c1-2-10-8-15-11(14-10)13-7-9-4-3-5-12-6-9/h3-6,10H,2,7-8H2,1H3,(H,13,14) |
| InChIKey | MLFJEZOHNUOAKZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|