C10H13N3S — CID 135934658
4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine (PubChem CID 135934658) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934658 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-methyl-N-(pyridin-3-ylmethyl)-1,3-thiazolidin-2-imine |
| SMILES | CC1CS/C(=N/Cc2cccnc2)N1 |
| InChI | InChI=1S/C10H13N3S/c1-8-7-14-10(13-8)12-6-9-3-2-4-11-5-9/h2-5,8H,6-7H2,1H3,(H,12,13) |
| InChIKey | CVVJCANNHXUZLN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|