C14H17N3S — CID 137002759
3-[[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]methyl]benzonitrile (PubChem CID 137002759) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 3-[[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]methyl]benzonitrile.
| Compound Name | 3-[[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 137002759 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-[[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]methyl]benzonitrile |
| SMILES | CC1CS/C(=N\Cc2cccc(C#N)c2)NC1C |
| InChI | InChI=1S/C14H17N3S/c1-10-9-18-14(17-11(10)2)16-8-13-5-3-4-12(6-13)7-15/h3-6,10-11H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | MYBAXYGGXKEBFZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|