C12H15FN2S — CID 135934664
4-ethyl-N-[(3-fluorophenyl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 135934664) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-ethyl-N-[(3-fluorophenyl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-[(3-fluorophenyl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934664 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-ethyl-N-[(3-fluorophenyl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N/Cc2cccc(F)c2)N1 |
| InChI | InChI=1S/C12H15FN2S/c1-2-11-8-16-12(15-11)14-7-9-4-3-5-10(13)6-9/h3-6,11H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | QTQNGRVOLQWWCP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|