C17H14FN5OS — CID 139311238
5-[2-[(3-fluorophenyl)methylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 139311238) has the molecular formula C17H14FN5OS and a molecular weight of 355.40 g/mol. Its IUPAC name is 5-[2-[(3-fluorophenyl)methylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-[(3-fluorophenyl)methylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 139311238 |
| Molecular Formula | C17H14FN5OS |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-[2-[(3-fluorophenyl)methylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C3=NN/C(=N/Cc4cccc(F)c4)SC3)cc2[nH]1 |
| InChI | InChI=1S/C17H14FN5OS/c18-12-3-1-2-10(6-12)8-19-17-23-22-15(9-25-17)11-4-5-13-14(7-11)21-16(24)20-13/h1-7H,8-9H2,(H,19,23)(H2,20,21,24) |
| InChIKey | LJIRTPKXDSSMLG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|