C15H17N3S — CID 136747075
3-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile (PubChem CID 136747075) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile.
| Compound Name | 3-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 136747075 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-[(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(C/N=C2/NC3CCCC3CS2)c1 |
| InChI | InChI=1S/C15H17N3S/c16-8-11-3-1-4-12(7-11)9-17-15-18-14-6-2-5-13(14)10-19-15/h1,3-4,7,13-14H,2,5-6,9-10H2,(H,17,18) |
| InChIKey | WZCLTXIJWAENTG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|