C16H20N2S — CID 136747201
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine (PubChem CID 136747201) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine |
|---|---|
| PubChem CID | 136747201 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine |
| SMILES | c1ccc2c(c1)CC2C/N=C1/NC2CCCC2CS1 |
| InChI | InChI=1S/C16H20N2S/c1-2-6-14-11(4-1)8-13(14)9-17-16-18-15-7-3-5-12(15)10-19-16/h1-2,4,6,12-13,15H,3,5,7-10H2,(H,17,18) |
| InChIKey | HOVISFBFUSVUHB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|