C15H18ClFN2S — CID 136747087
N-[(3-chloro-4-fluorophenyl)methyl]-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine (PubChem CID 136747087) has the molecular formula C15H18ClFN2S and a molecular weight of 312.84 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
|---|---|
| PubChem CID | 136747087 |
| Molecular Formula | C15H18ClFN2S |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
| SMILES | Fc1ccc(C/N=C2/NC3CCCCC3CS2)cc1Cl |
| InChI | InChI=1S/C15H18ClFN2S/c16-12-7-10(5-6-13(12)17)8-18-15-19-14-4-2-1-3-11(14)9-20-15/h5-7,11,14H,1-4,8-9H2,(H,18,19) |
| InChIKey | IRCLNMPYHBZTPD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|