C17H21ClFNO — CID 103042596
1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(3-chloro-4-fluorophenyl)ethanone (PubChem CID 103042596) has the molecular formula C17H21ClFNO and a molecular weight of 309.81 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(3-chloro-4-fluorophenyl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(3-chloro-4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 103042596 |
| Molecular Formula | C17H21ClFNO |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(3-chloro-4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)c(Cl)c1)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C17H21ClFNO/c18-13-9-11(5-7-14(13)19)10-17(21)16-8-6-12-3-1-2-4-15(12)20-16/h5,7,9,12,15-16,20H,1-4,6,8,10H2 |
| InChIKey | GSPJRALVFSSPHM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |