C17H22INO — CID 116586076
1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(4-iodophenyl)ethanone (PubChem CID 116586076) has the molecular formula C17H22INO and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(4-iodophenyl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 116586076 |
| Molecular Formula | C17H22INO |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-(4-iodophenyl)ethanone |
| SMILES | O=C(Cc1ccc(I)cc1)C1CCC2CCCCC2N1 |
| InChI | InChI=1S/C17H22INO/c18-14-8-5-12(6-9-14)11-17(20)16-10-7-13-3-1-2-4-15(13)19-16/h5-6,8-9,13,15-16,19H,1-4,7,10-11H2 |
| InChIKey | GCOKPMFNPYQNGW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|