C14H26N2S — CID 136747120
N-(4-methylpentyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine (PubChem CID 136747120) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is N-(4-methylpentyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine.
| Compound Name | N-(4-methylpentyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
|---|---|
| PubChem CID | 136747120 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-(4-methylpentyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
| SMILES | CC(C)CCC/N=C1/NC2CCCCC2CS1 |
| InChI | InChI=1S/C14H26N2S/c1-11(2)6-5-9-15-14-16-13-8-4-3-7-12(13)10-17-14/h11-13H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | DACXOCCVZSOOTQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|