C14H27N3S — CID 136747473
3-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-methyl-N-propan-2-ylpropan-1-amine (PubChem CID 136747473) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 3-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-methyl-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-methyl-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 136747473 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-(4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-ylideneamino)-N-methyl-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)N(C)CCC/N=C1/NC2CCCC2CS1 |
| InChI | InChI=1S/C14H27N3S/c1-11(2)17(3)9-5-8-15-14-16-13-7-4-6-12(13)10-18-14/h11-13H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | ZMQCEUJWDWCAES-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|