C13H21N3 — CID 64870565
3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,4-diazepane (PubChem CID 64870565) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,4-diazepane.
| Compound Name | 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64870565 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,4-diazepane |
| SMILES | CC1CN(Cc2cccnc2)C(C)CCN1 |
| InChI | InChI=1S/C13H21N3/c1-11-9-16(12(2)5-7-15-11)10-13-4-3-6-14-8-13/h3-4,6,8,11-12,15H,5,7,9-10H2,1-2H3 |
| InChIKey | YJYHLPUNCQLWQK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |