C16H25N3S — CID 135934573
N,N-diethyl-2-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]-1-phenylethanamine (PubChem CID 135934573) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N,N-diethyl-2-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]-1-phenylethanamine.
| Compound Name | N,N-diethyl-2-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]-1-phenylethanamine |
|---|---|
| PubChem CID | 135934573 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N,N-diethyl-2-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]-1-phenylethanamine |
| SMILES | CCN(CC)C(C/N=C1\NC(C)CS1)c1ccccc1 |
| InChI | InChI=1S/C16H25N3S/c1-4-19(5-2)15(14-9-7-6-8-10-14)11-17-16-18-13(3)12-20-16/h6-10,13,15H,4-5,11-12H2,1-3H3,(H,17,18) |
| InChIKey | YRMHTEHZYCFZEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|