C14H17N5S — CID 136824816
4-benzyl-N-[2-(triazol-1-yl)ethyl]-1,3-thiazolidin-2-imine (PubChem CID 136824816) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-benzyl-N-[2-(triazol-1-yl)ethyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-benzyl-N-[2-(triazol-1-yl)ethyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136824816 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-benzyl-N-[2-(triazol-1-yl)ethyl]-1,3-thiazolidin-2-imine |
| SMILES | c1ccc(CC2CS/C(=N\CCn3ccnn3)N2)cc1 |
| InChI | InChI=1S/C14H17N5S/c1-2-4-12(5-3-1)10-13-11-20-14(17-13)15-6-8-19-9-7-16-18-19/h1-5,7,9,13H,6,8,10-11H2,(H,15,17) |
| InChIKey | WKCNVNGKQMIBHH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|