C12H21N5S — CID 136824830
4,4-diethyl-N-[3-(triazol-1-yl)propyl]-1,3-thiazolidin-2-imine (PubChem CID 136824830) has the molecular formula C12H21N5S and a molecular weight of 267.40 g/mol. Its IUPAC name is 4,4-diethyl-N-[3-(triazol-1-yl)propyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4,4-diethyl-N-[3-(triazol-1-yl)propyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136824830 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4,4-diethyl-N-[3-(triazol-1-yl)propyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1(CC)CS/C(=N\CCCn2ccnn2)N1 |
| InChI | InChI=1S/C12H21N5S/c1-3-12(4-2)10-18-11(15-12)13-6-5-8-17-9-7-14-16-17/h7,9H,3-6,8,10H2,1-2H3,(H,13,15) |
| InChIKey | DZJCQQYBRHBLTB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|