C13H21N3S2 — CID 136908728
4,4-diethyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazolidin-2-imine (PubChem CID 136908728) has the molecular formula C13H21N3S2 and a molecular weight of 283.47 g/mol. Its IUPAC name is 4,4-diethyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4,4-diethyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136908728 |
| Molecular Formula | C13H21N3S2 |
| Molecular Weight | 283.47 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4,4-diethyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1(CC)CS/C(=N\CCc2csc(C)n2)N1 |
| InChI | InChI=1S/C13H21N3S2/c1-4-13(5-2)9-18-12(16-13)14-7-6-11-8-17-10(3)15-11/h8H,4-7,9H2,1-3H3,(H,14,16) |
| InChIKey | YDRDKPXFULDAFC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|