C10H15N3S — CID 106043191
N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]cyclopropanecarboximidamide (PubChem CID 106043191) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]cyclopropanecarboximidamide.
| Compound Name | N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 106043191 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N'-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]cyclopropanecarboximidamide |
| SMILES | Cc1nc(CC/N=C(\N)C2CC2)cs1 |
| InChI | InChI=1S/C10H15N3S/c1-7-13-9(6-14-7)4-5-12-10(11)8-2-3-8/h6,8H,2-5H2,1H3,(H2,11,12) |
| InChIKey | GQQRXELWGFRXDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|