C6H9NO2S2 — CID 68999544
2-(2-methyl-1,3-thiazol-4-yl)ethanesulfinic acid (PubChem CID 68999544) has the molecular formula C6H9NO2S2 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)ethanesulfinic acid.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)ethanesulfinic acid |
|---|---|
| PubChem CID | 68999544 |
| Molecular Formula | C6H9NO2S2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)ethanesulfinic acid |
| SMILES | Cc1nc(CCS(=O)O)cs1 |
| InChI | InChI=1S/C6H9NO2S2/c1-5-7-6(4-10-5)2-3-11(8)9/h4H,2-3H2,1H3,(H,8,9) |
| InChIKey | QAXQQKMNEGMCJD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|