C15H16N2OS — CID 136960723
4-benzyl-N-(furan-3-ylmethyl)-1,3-thiazolidin-2-imine (PubChem CID 136960723) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-benzyl-N-(furan-3-ylmethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-benzyl-N-(furan-3-ylmethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136960723 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-benzyl-N-(furan-3-ylmethyl)-1,3-thiazolidin-2-imine |
| SMILES | c1ccc(CC2CS/C(=N\Cc3ccoc3)N2)cc1 |
| InChI | InChI=1S/C15H16N2OS/c1-2-4-12(5-3-1)8-14-11-19-15(17-14)16-9-13-6-7-18-10-13/h1-7,10,14H,8-9,11H2,(H,16,17) |
| InChIKey | PAYDYRYRGICDKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|