About 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide
2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide (PubChem CID 136805731) has the molecular formula C14H19N3O2S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide.
Molecular Properties
| Compound Name | 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide |
| PubChem CID | 136805731 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCC/N=C1/NC(Cc2ccccc2)CS1 |
| InChI | InChI=1S/C14H19N3O2S/c15-13(18)9-19-7-6-16-14-17-12(10-20-14)8-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,15,18)(H,16,17) |
| InChIKey | KZQNATWPVPNPEM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide?
The IUPAC name of 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide (CID 136805731) is 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide.
What is the SMILES notation for 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide?
The canonical SMILES for 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide is NC(=O)COCC/N=C1/NC(Cc2ccccc2)CS1.
What is the InChIKey of 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide?
The InChIKey is KZQNATWPVPNPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2S/c15-13(18)9-19-7-6-16-14-17-12(10-20-14)8-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,15,18)(H,16,17).
What are the key properties of 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide?
2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide has a molecular weight of 293.39 g/mol, XLogP of 0.79, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-benzyl-1,3-thiazolidin-2-ylidene)amino]ethoxy]acetamide is sourced from PubChem (CID 136805731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).