About 4-benzyl-N-octyl-1,3-thiazolidin-2-imine
4-benzyl-N-octyl-1,3-thiazolidin-2-imine (PubChem CID 136920389) has the molecular formula C18H28N2S
and a molecular weight of 304.50 g/mol. Its IUPAC name is 4-benzyl-N-octyl-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | 4-benzyl-N-octyl-1,3-thiazolidin-2-imine |
| PubChem CID | 136920389 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4-benzyl-N-octyl-1,3-thiazolidin-2-imine |
| SMILES | CCCCCCCC/N=C1/NC(Cc2ccccc2)CS1 |
| InChI | InChI=1S/C18H28N2S/c1-2-3-4-5-6-10-13-19-18-20-17(15-21-18)14-16-11-8-7-9-12-16/h7-9,11-12,17H,2-6,10,13-15H2,1H3,(H,19,20) |
| InChIKey | GWSHYXMLZITVQU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N-octyl-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-octyl-1,3-thiazolidin-2-imine?
The IUPAC name of 4-benzyl-N-octyl-1,3-thiazolidin-2-imine (CID 136920389) is 4-benzyl-N-octyl-1,3-thiazolidin-2-imine.
What is the SMILES notation for 4-benzyl-N-octyl-1,3-thiazolidin-2-imine?
The canonical SMILES for 4-benzyl-N-octyl-1,3-thiazolidin-2-imine is CCCCCCCC/N=C1/NC(Cc2ccccc2)CS1.
What is the InChIKey of 4-benzyl-N-octyl-1,3-thiazolidin-2-imine?
The InChIKey is GWSHYXMLZITVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2S/c1-2-3-4-5-6-10-13-19-18-20-17(15-21-18)14-16-11-8-7-9-12-16/h7-9,11-12,17H,2-6,10,13-15H2,1H3,(H,19,20).
What are the key properties of 4-benzyl-N-octyl-1,3-thiazolidin-2-imine?
4-benzyl-N-octyl-1,3-thiazolidin-2-imine has a molecular weight of 304.50 g/mol, XLogP of 4.65, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-octyl-1,3-thiazolidin-2-imine is sourced from PubChem (CID 136920389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).