C14H28N2S — CID 136933398
4-ethyl-N-octyl-1,3-thiazinan-2-imine (PubChem CID 136933398) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-ethyl-N-octyl-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-octyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136933398 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 4-ethyl-N-octyl-1,3-thiazinan-2-imine |
| SMILES | CCCCCCCC/N=C1/NC(CC)CCS1 |
| InChI | InChI=1S/C14H28N2S/c1-3-5-6-7-8-9-11-15-14-16-13(4-2)10-12-17-14/h13H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | UKLYRIPUYKGICP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|