C9H18N2OS2 — CID 136933434
4-ethyl-N-(2-methylsulfinylethyl)-1,3-thiazinan-2-imine (PubChem CID 136933434) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-ethyl-N-(2-methylsulfinylethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-(2-methylsulfinylethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136933434 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-ethyl-N-(2-methylsulfinylethyl)-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\CCS(C)=O)N1 |
| InChI | InChI=1S/C9H18N2OS2/c1-3-8-4-6-13-9(11-8)10-5-7-14(2)12/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | JPTBTVUVBQMZLA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|