C9H18N2O2S2 — CID 136933241
4-ethyl-N-(2-methylsulfonylethyl)-1,3-thiazinan-2-imine (PubChem CID 136933241) has the molecular formula C9H18N2O2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-ethyl-N-(2-methylsulfonylethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-(2-methylsulfonylethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136933241 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-ethyl-N-(2-methylsulfonylethyl)-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\CCS(C)(=O)=O)N1 |
| InChI | InChI=1S/C9H18N2O2S2/c1-3-8-4-6-14-9(11-8)10-5-7-15(2,12)13/h8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | CRUNUOJVUJFVJN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|