About N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide
N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide (PubChem CID 136933416) has the molecular formula C13H25N3OS
and a molecular weight of 271.43 g/mol. Its IUPAC name is N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide.
Molecular Properties
| Compound Name | N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide |
| PubChem CID | 136933416 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide |
| SMILES | CCC1CCS/C(=N\CCC(=O)N(CC)CC)N1 |
| InChI | InChI=1S/C13H25N3OS/c1-4-11-8-10-18-13(15-11)14-9-7-12(17)16(5-2)6-3/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | YBJACLJLHMHIQU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide?
The IUPAC name of N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide (CID 136933416) is N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide.
What is the SMILES notation for N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide?
The canonical SMILES for N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide is CCC1CCS/C(=N\CCC(=O)N(CC)CC)N1.
What is the InChIKey of N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide?
The InChIKey is YBJACLJLHMHIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3OS/c1-4-11-8-10-18-13(15-11)14-9-7-12(17)16(5-2)6-3/h11H,4-10H2,1-3H3,(H,14,15).
What are the key properties of N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide?
N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide has a molecular weight of 271.43 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide is sourced from PubChem (CID 136933416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).