C10H15N3S2 — CID 136933339
4-ethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-thiazinan-2-imine (PubChem CID 136933339) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-ethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136933339 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 4-ethyl-N-(1,3-thiazol-4-ylmethyl)-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\Cc2cscn2)N1 |
| InChI | InChI=1S/C10H15N3S2/c1-2-8-3-4-15-10(13-8)11-5-9-6-14-7-12-9/h6-8H,2-5H2,1H3,(H,11,13) |
| InChIKey | IWCGZDYUYKQZMZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|