C12H17N3S2 — CID 136993517
N-[2-(1,3-thiazol-4-yl)ethyl]-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine (PubChem CID 136993517) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-4-yl)ethyl]-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine.
| Compound Name | N-[2-(1,3-thiazol-4-yl)ethyl]-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine |
|---|---|
| PubChem CID | 136993517 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[2-(1,3-thiazol-4-yl)ethyl]-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[d][1,3]thiazin-2-imine |
| SMILES | c1nc(CC/N=C2/NC3CCCC3CS2)cs1 |
| InChI | InChI=1S/C12H17N3S2/c1-2-9-6-17-12(15-11(9)3-1)13-5-4-10-7-16-8-14-10/h7-9,11H,1-6H2,(H,13,15) |
| InChIKey | KXIOCDONAGLKCW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|