C9H14F4N2S — CID 136819417
4-ethyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazinan-2-imine (PubChem CID 136819417) has the molecular formula C9H14F4N2S and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-ethyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-ethyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136819417 |
| Molecular Formula | C9H14F4N2S |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-ethyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\CC(F)(F)C(F)F)N1 |
| InChI | InChI=1S/C9H14F4N2S/c1-2-6-3-4-16-8(15-6)14-5-9(12,13)7(10)11/h6-7H,2-5H2,1H3,(H,14,15) |
| InChIKey | VMUJHDQOUIXXRL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|