C13H26N4S — CID 136933344
N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-ethyl-1,3-thiazinan-2-imine (PubChem CID 136933344) has the molecular formula C13H26N4S and a molecular weight of 270.45 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-ethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-ethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136933344 |
| Molecular Formula | C13H26N4S |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-ethyl-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\CC2CN(C)CCN2C)N1 |
| InChI | InChI=1S/C13H26N4S/c1-4-11-5-8-18-13(15-11)14-9-12-10-16(2)6-7-17(12)3/h11-12H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | OONNCLRWLVOJFX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|