C13H24N2OS — CID 137017283
N-[3-(cyclopropylmethoxy)propyl]-4-ethyl-1,3-thiazinan-2-imine (PubChem CID 137017283) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N-[3-(cyclopropylmethoxy)propyl]-4-ethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[3-(cyclopropylmethoxy)propyl]-4-ethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 137017283 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-[3-(cyclopropylmethoxy)propyl]-4-ethyl-1,3-thiazinan-2-imine |
| SMILES | CCC1CCS/C(=N\CCCOCC2CC2)N1 |
| InChI | InChI=1S/C13H24N2OS/c1-2-12-6-9-17-13(15-12)14-7-3-8-16-10-11-4-5-11/h11-12H,2-10H2,1H3,(H,14,15) |
| InChIKey | YIKBSYCZNGSHFQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|