C13H25N3OS — CID 136933414
N-tert-butyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide (PubChem CID 136933414) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-tert-butyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide.
| Compound Name | N-tert-butyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 136933414 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-tert-butyl-3-[(4-ethyl-1,3-thiazinan-2-ylidene)amino]propanamide |
| SMILES | CCC1CCS/C(=N\CCC(=O)NC(C)(C)C)N1 |
| InChI | InChI=1S/C13H25N3OS/c1-5-10-7-9-18-12(15-10)14-8-6-11(17)16-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | WKFCYRDRSMBNJA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|