C9H17N3OS — CID 136805725
5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide (PubChem CID 136805725) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide.
| Compound Name | 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide |
|---|---|
| PubChem CID | 136805725 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide |
| SMILES | CC1CS/C(=N\CCCCC(N)=O)N1 |
| InChI | InChI=1S/C9H17N3OS/c1-7-6-14-9(12-7)11-5-3-2-4-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | MSOYHFSPFZZBJH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|