About 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide
5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide (PubChem CID 136805725) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide.
Molecular Properties
| Compound Name | 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide |
| PubChem CID | 136805725 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide |
| SMILES | CC1CS/C(=N\CCCCC(N)=O)N1 |
| InChI | InChI=1S/C9H17N3OS/c1-7-6-14-9(12-7)11-5-3-2-4-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | MSOYHFSPFZZBJH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide?
The IUPAC name of 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide (CID 136805725) is 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide.
What is the SMILES notation for 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide?
The canonical SMILES for 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide is CC1CS/C(=N\CCCCC(N)=O)N1.
What is the InChIKey of 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide?
The InChIKey is MSOYHFSPFZZBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS/c1-7-6-14-9(12-7)11-5-3-2-4-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12).
What are the key properties of 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide?
5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide has a molecular weight of 215.32 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methyl-1,3-thiazolidin-2-ylidene)amino]pentanamide is sourced from PubChem (CID 136805725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).