About 10-nitrosodecanamide
10-nitrosodecanamide (PubChem CID 146175538) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 10-nitrosodecanamide.
Molecular Properties
| Compound Name | 10-nitrosodecanamide |
| PubChem CID | 146175538 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 10-nitrosodecanamide |
| SMILES | NC(=O)CCCCCCCCCN=O |
| InChI | InChI=1S/C10H20N2O2/c11-10(13)8-6-4-2-1-3-5-7-9-12-14/h1-9H2,(H2,11,13) |
| InChIKey | LMFSXCKDENUKGV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-nitrosodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-nitrosodecanamide?
The IUPAC name of 10-nitrosodecanamide (CID 146175538) is 10-nitrosodecanamide.
What is the SMILES notation for 10-nitrosodecanamide?
The canonical SMILES for 10-nitrosodecanamide is NC(=O)CCCCCCCCCN=O.
What is the InChIKey of 10-nitrosodecanamide?
The InChIKey is LMFSXCKDENUKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c11-10(13)8-6-4-2-1-3-5-7-9-12-14/h1-9H2,(H2,11,13).
What are the key properties of 10-nitrosodecanamide?
10-nitrosodecanamide has a molecular weight of 200.28 g/mol, XLogP of 2.36, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitrosodecanamide is sourced from PubChem (CID 146175538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).