C7H12N2S — CID 135934531
N-cyclopropyl-4-methyl-1,3-thiazolidin-2-imine (PubChem CID 135934531) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-1,3-thiazolidin-2-imine.
| Compound Name | N-cyclopropyl-4-methyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934531 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N-cyclopropyl-4-methyl-1,3-thiazolidin-2-imine |
| SMILES | CC1CS/C(=N\C2CC2)N1 |
| InChI | InChI=1S/C7H12N2S/c1-5-4-10-7(8-5)9-6-2-3-6/h5-6H,2-4H2,1H3,(H,8,9) |
| InChIKey | FQKIOQSFCVZBDO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|