C9H17N3O2S — CID 136805740
2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide (PubChem CID 136805740) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 136805740 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide |
| SMILES | CC1CCS/C(=N\CCOCC(N)=O)N1 |
| InChI | InChI=1S/C9H17N3O2S/c1-7-2-5-15-9(12-7)11-3-4-14-6-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | WXUWPQSRHRAAAX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|