About 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide
2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide (PubChem CID 136805740) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide.
Molecular Properties
| Compound Name | 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide |
| PubChem CID | 136805740 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide |
| SMILES | CC1CCS/C(=N\CCOCC(N)=O)N1 |
| InChI | InChI=1S/C9H17N3O2S/c1-7-2-5-15-9(12-7)11-3-4-14-6-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | WXUWPQSRHRAAAX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide?
The IUPAC name of 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide (CID 136805740) is 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide.
What is the SMILES notation for 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide?
The canonical SMILES for 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide is CC1CCS/C(=N\CCOCC(N)=O)N1.
What is the InChIKey of 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide?
The InChIKey is WXUWPQSRHRAAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-7-2-5-15-9(12-7)11-3-4-14-6-8(10)13/h7H,2-6H2,1H3,(H2,10,13)(H,11,12).
What are the key properties of 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide?
2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide has a molecular weight of 231.32 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-methyl-1,3-thiazinan-2-ylidene)amino]ethoxy]acetamide is sourced from PubChem (CID 136805740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).