C13H27N3OS — CID 137010948
N-ethyl-N-[2-[[4-(2-methoxyethyl)-1,3-thiazolidin-2-ylidene]amino]ethyl]propan-1-amine (PubChem CID 137010948) has the molecular formula C13H27N3OS and a molecular weight of 273.45 g/mol. Its IUPAC name is N-ethyl-N-[2-[[4-(2-methoxyethyl)-1,3-thiazolidin-2-ylidene]amino]ethyl]propan-1-amine.
| Compound Name | N-ethyl-N-[2-[[4-(2-methoxyethyl)-1,3-thiazolidin-2-ylidene]amino]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 137010948 |
| Molecular Formula | C13H27N3OS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-ethyl-N-[2-[[4-(2-methoxyethyl)-1,3-thiazolidin-2-ylidene]amino]ethyl]propan-1-amine |
| SMILES | CCCN(CC)CC/N=C1/NC(CCOC)CS1 |
| InChI | InChI=1S/C13H27N3OS/c1-4-8-16(5-2)9-7-14-13-15-12(11-18-13)6-10-17-3/h12H,4-11H2,1-3H3,(H,14,15) |
| InChIKey | AINVQYQZEXWOCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|