C11H18N4OS — CID 137010916
4-(2-methoxyethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 137010916) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-(2-methoxyethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 137010916 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-(2-methoxyethyl)-N-[(1-methylpyrazol-3-yl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | COCCC1CS/C(=N\Cc2ccn(C)n2)N1 |
| InChI | InChI=1S/C11H18N4OS/c1-15-5-3-9(14-15)7-12-11-13-10(8-17-11)4-6-16-2/h3,5,10H,4,6-8H2,1-2H3,(H,12,13) |
| InChIKey | HDDHBQGTLGESRI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|