C12H23N3OS — CID 136951355
3-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide (PubChem CID 136951355) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide.
| Compound Name | 3-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 136951355 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CC/N=C1/NC(CC)(CC)CS1 |
| InChI | InChI=1S/C12H23N3OS/c1-4-12(5-2)9-17-11(15-12)14-8-7-10(16)13-6-3/h4-9H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | FTXDWXBNQMRJDM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|