C10H19N3OS — CID 136984877
2-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-ethylacetamide (PubChem CID 136984877) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-ethylacetamide.
| Compound Name | 2-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 136984877 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-[(4,4-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C1/NC(C)(C)CCS1 |
| InChI | InChI=1S/C10H19N3OS/c1-4-11-8(14)7-12-9-13-10(2,3)5-6-15-9/h4-7H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | XZNCCJMQJLLKIU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|