C11H22N2S — CID 136984895
N-(2,2-dimethylpropyl)-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136984895) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(2,2-dimethylpropyl)-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136984895 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-(2,2-dimethylpropyl)-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CC(C)(C)C/N=C1/NC(C)(C)CCS1 |
| InChI | InChI=1S/C11H22N2S/c1-10(2,3)8-12-9-13-11(4,5)6-7-14-9/h6-8H2,1-5H3,(H,12,13) |
| InChIKey | SEQKCVJQUSRSFQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|