C13H26N2S2 — CID 136964207
N-(2-ethyl-2-methylsulfanylbutyl)-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136964207) has the molecular formula C13H26N2S2 and a molecular weight of 274.50 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136964207 |
| Molecular Formula | C13H26N2S2 |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CCC(CC)(C/N=C1/NC(C)(C)CCS1)SC |
| InChI | InChI=1S/C13H26N2S2/c1-6-13(7-2,16-5)10-14-11-15-12(3,4)8-9-17-11/h6-10H2,1-5H3,(H,14,15) |
| InChIKey | KOWLIPQSBLTJBV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|