C15H28N2S2 — CID 136762648
N-(2-ethyl-2-methylsulfanylbutyl)-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 136762648) has the molecular formula C15H28N2S2 and a molecular weight of 300.54 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 136762648 |
| Molecular Formula | C15H28N2S2 |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | CCC(CC)(C/N=C1/NC2(CCCCC2)CS1)SC |
| InChI | InChI=1S/C15H28N2S2/c1-4-15(5-2,18-3)11-16-13-17-14(12-19-13)9-7-6-8-10-14/h4-12H2,1-3H3,(H,16,17) |
| InChIKey | LTQMOSUZNOQNAZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|