C14H25N3OS — CID 136817724
N,2,2-trimethyl-3-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide (PubChem CID 136817724) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide.
| Compound Name | N,2,2-trimethyl-3-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide |
|---|---|
| PubChem CID | 136817724 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N,2,2-trimethyl-3-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide |
| SMILES | CNC(=O)C(C)(C)C/N=C1/NC2(CCCCC2)CS1 |
| InChI | InChI=1S/C14H25N3OS/c1-13(2,11(18)15-3)9-16-12-17-14(10-19-12)7-5-4-6-8-14/h4-10H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | RLKGAMWGPQMEMC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|