C11H20N2S — CID 135977348
N-propyl-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 135977348) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-propyl-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-propyl-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 135977348 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-propyl-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | CCC/N=C1/NC2(CCCCC2)CS1 |
| InChI | InChI=1S/C11H20N2S/c1-2-8-12-10-13-11(9-14-10)6-4-3-5-7-11/h2-9H2,1H3,(H,12,13) |
| InChIKey | PLORTWBDIAJKNY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|